chemistry is a service identifier in Ф architecture, providing on-demand rendering of chemical structures from SMILES strings. Its canonical public endpoint is chemistry.fuyeor.net.
Built on RDKit to deliver high-performance SVG chemical diagrams for use in social, academic, and research platforms.
GET /v1/depict
Renders a SMILES string as a chemical structure image.
Note: Must provide either
smilesorname, but not both.
| Parameter | Type | Required | Description |
|---|---|---|---|
smiles |
string | Conditional | A valid SMILES or Reaction SMILES string. |
name |
string | Conditional | A case-insensitive English common name (e.g., "aspirin", "ethanol"). |
color |
string | Optional | Override the stroke/atom color. Format: Hex (e.g., ff0000, #00ff00). Default is black. |
| Molecule | SMILES | Structure |
|---|---|---|
| Aspirin | CC(=O)OC1=CC=CC=C1C(=O)O |
|
| Caffeine | CN1C=NC2=C1C(=O)N(C(=O)N2C)C |
|
| Ethanol | CCO |
This project is licensed under the MIT License.
It uses RDKit, an open-source cheminformatics library licensed under the BSD 3-Clause License.